Metadata-Version: 2.1
Name: PubChemQuery
Version: 1.5.0
Summary: A Python Package for Accessing Chemical Information from PubChem (https://pubchem.ncbi.nlm.nih.gov/).
Author: Sina Gilassi
Author-email: <sina.gilassi@gmail.com>
License: MIT
Keywords: python,PubChem,PubChemAPI,PubChemQuery,pubchemquery
Classifier: Development Status :: 1 - Planning
Classifier: Intended Audience :: Education
Classifier: Programming Language :: Python :: 3
Classifier: Operating System :: Unix
Classifier: Operating System :: MacOS :: MacOS X
Classifier: Operating System :: Microsoft :: Windows
Requires-Python: >=3.6
Description-Content-Type: text/markdown
License-File: LICENSE
Requires-Dist: pandas
Requires-Dist: pillow
Requires-Dist: requests
Requires-Dist: urllib3


# PubChemQuery



![Downloads](https://img.shields.io/pypi/dm/PubChemQuery) ![PyPI](https://img.shields.io/pypi/v/PubChemQuery) ![Python Version](https://img.shields.io/pypi/pyversions/PubChemQuery.svg) ![License](https://img.shields.io/pypi/l/PubChemQuery) [![Open In Colab](https://colab.research.google.com/assets/colab-badge.svg)](https://colab.research.google.com/drive/1hKrOe6K1L_fpd6_izhpVXaA1Zmq6Z8Fo?usp=sharing)



**PubChemQuery:** A Python Package for Accessing Chemical Information from [PubChem](https://pubchem.ncbi.nlm.nih.gov/).



PubChemQuery is a Python package that provides a simple and intuitive API for retrieving chemical information from the PubChem database. With this package, you can easily fetch chemical data, including:



* CID (Compound ID) by name

* All CIDs by name

* 2D images by CID or name

* SDF (Structure Data File) by CID or name

* Compound properties, including:

    - Molecular formula and weight

    - SMILES and InChI representations

    - IUPAC name and title

    - Physicochemical properties (e.g., XLogP, exact mass, TPSA)

    - Structural features (e.g., bond and atom counts, stereochemistry)

    - 3D properties (e.g., volume, steric quadrupole moments, feature counts)

    - Fingerprint and conformer information



The package offers a straightforward interface, allowing users to access PubChem data with minimal code. Whether you're a chemist, researcher, or developer, PubChemQuery simplifies the process of integrating chemical information into your projects.



**Key Features:**



Retrieve chemical data by name or CID

Access 2D images and SDF files

Get compound properties, including physicochemical, structural, and 3D features

Easy-to-use API with minimal code required



**Simple and Concise API:**



There are functions that perform all of the above-mentioned tasks, making it easy to integrate PubChem data into your projects:



* `get_cid_by_inchi(inchi)`: Get a CID by InChI

* `get_cids_by_formula(formula)`: Get CIDs by formula

* `get_cid_by_name(name)`: Get CID by name

* `get_cids_by_name(name)`: Get all CIDs by name

* `get_image_by_cid(cid)`: Get 2D image by CID

* `get_image_by_name(name)`: Get 2D image by name

* `get_image_by_inchi(inchi)`: Get 2D image by InChI

* `get_structure_by_cid(cid)`: Get SDF by CID

* `get_structure_by_name(name)`: Get SDF by name

* `get_similar_structures_cids_by_compound_id(cid/SMILES/InChI)`: Get similar structures CIDs by cid, SMILES, InChI



**Compound Object:**

The package also includes a `Compound` object that encapsulates the retrieved data, providing a convenient way

to access and manipulate the data.



* `compound(cid_or_name)`: Create a compound object with properties and methods



**Getting Started:**



To use PubChemQuery, simply install the package and import it into your Python script. Refer to the example code snippets above for a quick start.



## Installation



Install PubChemQuery with pip



```python

  pip install PubChemQuery

```



## Examples



Import package as:



```python

import pubchemquery as pcq

```



Use the functions to retrieve data:



```python

# get a cid by formula

cid = pcq.get_cids_by_formula('C6H6')

print(type(cid), len(cid))

```



```python

# get a cid by inchi

cid = pcq.get_cid_by_inchi(

    'InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H')

print(cid)

```



```python

# get a cid by name

cid = pcq.get_cid_by_name('benzene')

print(cid)

```



```python

# get all cids by name

cids = pcq.get_cids_by_name('benzene')

print(type(cids), len(cids))

```



```python

# get 2d image

# by cid

image = pcq.get_image_by_cid('241')

image



# by name

image = pcq.get_image_by_name('benzene')

image



# by inchi

image = pcq.get_image_by_inchi(

    'InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H')

print(image)

```



```python

# get sdf by cid

sdf = pcq.get_structure_by_cid('241')

print(sdf)

```



```python

# get sdf by name

sdf = pcq.get_structure_by_name('benzene')

print(sdf)

```



```python

# get similar structure cids by cid

# cids = pcq.get_similar_structures_cids_by_compound_id('241')

# cids = pcq.get_similar_structures_cids_by_compound_id(

#     'C1=CC=CC=C1', compound_id='SMILES')

cids = pcq.get_similar_structures_cids_by_compound_id(

    'InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H', compound_id='InChI')

print(type(cids), len(cids))

```



Make a compound and then get its properties:



```python

# make a compound

cid = 2244

# compound = pcq.compound(cid)

# name

name = '2-acetyloxybenzoic acid'

compound = pcq.compound(name)

print(compound)

# properties

# InChI

print(compound.InChI)

# InChIKey

print(compound.InChIKey)

# IUPACName

print(compound.IUPACName)

# similar structure cids

print(len(compound.similar_structure_cids))

# image

compound.image

# dataframe

compound.prop_df()

```



## FAQ



For any question, contact me on [LinkedIn](https://www.linkedin.com/in/sina-gilassi/) 





## Authors



- [@sinagilassi](https://www.github.com/sinagilassi)

